C17H14F3IN2O5 — CID 10436349
(2S)-2-hydroxy-3-(4-iodophenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 10436349) has the molecular formula C17H14F3IN2O5 and a molecular weight of 510.21 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-(4-iodophenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-hydroxy-3-(4-iodophenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 10436349 |
| Molecular Formula | C17H14F3IN2O5 |
| Molecular Weight | 510.21 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | (2S)-2-hydroxy-3-(4-iodophenoxy)-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@](O)(COc1ccc(I)cc1)C(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3IN2O5/c1-16(25,9-28-12-5-2-10(21)3-6-12)15(24)22-11-4-7-14(23(26)27)13(8-11)17(18,19)20/h2-8,25H,9H2,1H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | PJANTQSJBUANIU-INIZCTEOSA-N |
| XLogP | 3.99 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|