C31H37N3O4 — CID 10436564
(2R)-2-[[(2S)-1-[[(2S)-1-anilino-1-oxo-6-phenylhexan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid (PubChem CID 10436564) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is (2R)-2-[[(2S)-1-[[(2S)-1-anilino-1-oxo-6-phenylhexan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-1-[[(2S)-1-anilino-1-oxo-6-phenylhexan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 10436564 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | (2R)-2-[[(2S)-1-[[(2S)-1-anilino-1-oxo-6-phenylhexan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid |
| SMILES | C[C@@H](N[C@@H](CCc1ccccc1)C(=O)N[C@@H](CCCCc1ccccc1)C(=O)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H37N3O4/c1-23(31(37)38)32-28(22-21-25-15-7-3-8-16-25)30(36)34-27(29(35)33-26-18-9-4-10-19-26)20-12-11-17-24-13-5-2-6-14-24/h2-10,13-16,18-19,23,27-28,32H,11-12,17,20-22H2,1H3,(H,33,35)(H,34,36)(H,37,38)/t23-,27+,28+/m1/s1 |
| InChIKey | CKHLKXZFRFZPPG-UIUQJESISA-N |
| XLogP | 4.59 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|