C25H38N6O6 — CID 10436647
(3S,6S,9S,12S)-9-(4-aminobutyl)-6-[(4-hydroxyphenyl)methyl]-3-methyl-12-propan-2-yl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone (PubChem CID 10436647) has the molecular formula C25H38N6O6 and a molecular weight of 518.62 g/mol. Its IUPAC name is (3S,6S,9S,12S)-9-(4-aminobutyl)-6-[(4-hydroxyphenyl)methyl]-3-methyl-12-propan-2-yl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,6S,9S,12S)-9-(4-aminobutyl)-6-[(4-hydroxyphenyl)methyl]-3-methyl-12-propan-2-yl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 10436647 |
| Molecular Formula | C25H38N6O6 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (3S,6S,9S,12S)-9-(4-aminobutyl)-6-[(4-hydroxyphenyl)methyl]-3-methyl-12-propan-2-yl-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
| SMILES | CC(C)[C@@H]1NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](CCCCN)NC1=O |
| InChI | InChI=1S/C25H38N6O6/c1-14(2)21-25(37)29-18(6-4-5-11-26)23(35)30-19(12-16-7-9-17(32)10-8-16)24(36)28-15(3)22(34)27-13-20(33)31-21/h7-10,14-15,18-19,21,32H,4-6,11-13,26H2,1-3H3,(H,27,34)(H,28,36)(H,29,37)(H,30,35)(H,31,33)/t15-,18-,19-,21-/m0/s1 |
| InChIKey | UGXIEHVKQAMBQN-QTWZMDIBSA-N |
| XLogP | -1.19 |
| TPSA | 191.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|