About 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one
7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 1043672) has the molecular formula C19H11BrN2O5
and a molecular weight of 427.21 g/mol. Its IUPAC name is 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one.
Molecular Properties
| Compound Name | 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one |
| PubChem CID | 1043672 |
| Molecular Formula | C19H11BrN2O5 |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | O=C1Nc2ccccc2Oc2cc([N+](=O)[O-])cc(Oc3ccc(Br)cc3)c21 |
| InChI | InChI=1S/C19H11BrN2O5/c20-11-5-7-13(8-6-11)26-16-9-12(22(24)25)10-17-18(16)19(23)21-14-3-1-2-4-15(14)27-17/h1-10H,(H,21,23) |
| InChIKey | GDECPDFQIBQMRI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one?
The IUPAC name of 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one (CID 1043672) is 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one.
What is the SMILES notation for 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one?
The canonical SMILES for 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one is O=C1Nc2ccccc2Oc2cc([N+](=O)[O-])cc(Oc3ccc(Br)cc3)c21.
What is the InChIKey of 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one?
The InChIKey is GDECPDFQIBQMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11BrN2O5/c20-11-5-7-13(8-6-11)26-16-9-12(22(24)25)10-17-18(16)19(23)21-14-3-1-2-4-15(14)27-17/h1-10H,(H,21,23).
What are the key properties of 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one?
7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one has a molecular weight of 427.21 g/mol, XLogP of 5.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-bromophenoxy)-9-nitro-5H-benzo[b][1,4]benzoxazepin-6-one is sourced from PubChem (CID 1043672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).