C30H42N4O2S — CID 10436790
1-(2-butoxyethyl)-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea (PubChem CID 10436790) has the molecular formula C30H42N4O2S and a molecular weight of 522.76 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea.
| Compound Name | 1-(2-butoxyethyl)-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 10436790 |
| Molecular Formula | C30H42N4O2S |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 1-(2-butoxyethyl)-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea |
| SMILES | CCCCOCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)NC(C)C |
| InChI | InChI=1S/C30H42N4O2S/c1-4-5-21-36-22-20-34(30(35)31-24(2)3)19-13-8-14-23-37-29-32-27(25-15-9-6-10-16-25)28(33-29)26-17-11-7-12-18-26/h6-7,9-12,15-18,24H,4-5,8,13-14,19-23H2,1-3H3,(H,31,35)(H,32,33) |
| InChIKey | BLACHSSXUKUSFC-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|