C30H45NO5Si — CID 10436942
(2S,4S,5S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid (PubChem CID 10436942) has the molecular formula C30H45NO5Si and a molecular weight of 527.78 g/mol. Its IUPAC name is (2S,4S,5S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid.
| Compound Name | (2S,4S,5S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 10436942 |
| Molecular Formula | C30H45NO5Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | (2S,4S,5S)-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](C[C@H](Cc1ccccc1)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H45NO5Si/c1-29(2,3)35-28(34)31-25(20-23-17-13-10-14-18-23)26(36-37(7,8)30(4,5)6)21-24(27(32)33)19-22-15-11-9-12-16-22/h9-18,24-26H,19-21H2,1-8H3,(H,31,34)(H,32,33)/t24-,25-,26-/m0/s1 |
| InChIKey | UEVGWVOLUCPPDE-GSDHBNRESA-N |
| XLogP | 6.85 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|