About tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate
tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate (PubChem CID 10437362) has the molecular formula C24H44N2O4Sn
and a molecular weight of 543.34 g/mol. Its IUPAC name is tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate |
| PubChem CID | 10437362 |
| Molecular Formula | C24H44N2O4Sn |
| Molecular Weight | 543.34 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(OC)nc(OC)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H17N2O4.3C4H9.Sn/c1-12(2,3)18-11(15)13-8-6-7-9(16-4)14-10(8)17-5;3*1-3-4-2;/h7H,1-5H3,(H,13,15);3*1,3-4H2,2H3; |
| InChIKey | RAGHWMNXVCDSPB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.34 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate?
The IUPAC name of tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate (CID 10437362) is tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate.
What is the SMILES notation for tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate?
The canonical SMILES for tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate is CCCC[Sn](CCCC)(CCCC)c1cc(OC)nc(OC)c1NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate?
The InChIKey is RAGHWMNXVCDSPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N2O4.3C4H9.Sn/c1-12(2,3)18-11(15)13-8-6-7-9(16-4)14-10(8)17-5;3*1-3-4-2;/h7H,1-5H3,(H,13,15);3*1,3-4H2,2H3;.
What are the key properties of tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate?
tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate has a molecular weight of 543.34 g/mol, XLogP of 6.50, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2,6-dimethoxy-4-tributylstannyl-3-pyridinyl)carbamate is sourced from PubChem (CID 10437362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).