C26H30F6N2O4 — CID 10437488
2-[2-[4-[(1S)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]piperazin-1-yl]ethoxy]acetic acid (PubChem CID 10437488) has the molecular formula C26H30F6N2O4 and a molecular weight of 548.52 g/mol. Its IUPAC name is 2-[2-[4-[(1S)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]piperazin-1-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[(1S)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]piperazin-1-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 10437488 |
| Molecular Formula | C26H30F6N2O4 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 2-[2-[4-[(1S)-2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]piperazin-1-yl]ethoxy]acetic acid |
| SMILES | C[C@H](OC[C@H](c1ccccc1)N1CCN(CCOCC(=O)O)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H30F6N2O4/c1-18(20-13-21(25(27,28)29)15-22(14-20)26(30,31)32)38-16-23(19-5-3-2-4-6-19)34-9-7-33(8-10-34)11-12-37-17-24(35)36/h2-6,13-15,18,23H,7-12,16-17H2,1H3,(H,35,36)/t18-,23+/m0/s1 |
| InChIKey | VONJODYKTRPIQC-FDDCHVKYSA-N |
| XLogP | 5.26 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|