C25H27NO6S — CID 1043768
methyl (4S,7S)-2-methyl-5-oxo-7-thiophen-2-yl-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1043768) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is methyl (4S,7S)-2-methyl-5-oxo-7-thiophen-2-yl-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | methyl (4S,7S)-2-methyl-5-oxo-7-thiophen-2-yl-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1043768 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | methyl (4S,7S)-2-methyl-5-oxo-7-thiophen-2-yl-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3cccs3)C2)[C@@H]1c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C25H27NO6S/c1-13-20(25(28)32-5)21(15-8-9-18(29-2)24(31-4)23(15)30-3)22-16(26-13)11-14(12-17(22)27)19-7-6-10-33-19/h6-10,14,21,26H,11-12H2,1-5H3/t14-,21+/m0/s1 |
| InChIKey | UHZKAJWBEKWXFW-LHSJRXKWSA-N |
| XLogP | 4.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |