C34H44N4O3 — CID 10437715
benzyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-phenyl-3-(4-piperidin-1-ylanilino)propan-2-yl]amino]pentan-2-yl]carbamate (PubChem CID 10437715) has the molecular formula C34H44N4O3 and a molecular weight of 556.75 g/mol. Its IUPAC name is benzyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-phenyl-3-(4-piperidin-1-ylanilino)propan-2-yl]amino]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-phenyl-3-(4-piperidin-1-ylanilino)propan-2-yl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10437715 |
| Molecular Formula | C34H44N4O3 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | benzyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-phenyl-3-(4-piperidin-1-ylanilino)propan-2-yl]amino]pentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](CNc1ccc(N2CCCCC2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H44N4O3/c1-26(2)22-32(37-34(40)41-25-28-14-8-4-9-15-28)33(39)36-30(23-27-12-6-3-7-13-27)24-35-29-16-18-31(19-17-29)38-20-10-5-11-21-38/h3-4,6-9,12-19,26,30,32,35H,5,10-11,20-25H2,1-2H3,(H,36,39)(H,37,40)/t30-,32-/m0/s1 |
| InChIKey | FSRHVGXBAZIREQ-CDZUIXILSA-N |
| XLogP | 6.16 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|