C32H34O8 — CID 1043800
bis[(2R)-3,3,5-trimethyl-6-oxo-2-phenyl-2H-pyran-4-yl] butanedioate (PubChem CID 1043800) has the molecular formula C32H34O8 and a molecular weight of 546.62 g/mol. Its IUPAC name is bis[(2R)-3,3,5-trimethyl-6-oxo-2-phenyl-2H-pyran-4-yl] butanedioate.
| Compound Name | bis[(2R)-3,3,5-trimethyl-6-oxo-2-phenyl-2H-pyran-4-yl] butanedioate |
|---|---|
| PubChem CID | 1043800 |
| Molecular Formula | C32H34O8 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | bis[(2R)-3,3,5-trimethyl-6-oxo-2-phenyl-2H-pyran-4-yl] butanedioate |
| SMILES | CC1=C(OC(=O)CCC(=O)OC2=C(C)C(=O)O[C@H](c3ccccc3)C2(C)C)C(C)(C)[C@@H](c2ccccc2)OC1=O |
| InChI | InChI=1S/C32H34O8/c1-19-25(31(3,4)27(39-29(19)35)21-13-9-7-10-14-21)37-23(33)17-18-24(34)38-26-20(2)30(36)40-28(32(26,5)6)22-15-11-8-12-16-22/h7-16,27-28H,17-18H2,1-6H3/t27-,28-/m1/s1 |
| InChIKey | BZEYOLOPNZWUGC-VSGBNLITSA-N |
| XLogP | 6.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|