C37H50O6 — CID 10438397
[(1R,3E,7E)-4-(acetyloxymethyl)-8-methyl-1-(5-oxo-2H-furan-3-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl] 2-phenylbutanoate (PubChem CID 10438397) has the molecular formula C37H50O6 and a molecular weight of 590.80 g/mol. Its IUPAC name is [(1R,3E,7E)-4-(acetyloxymethyl)-8-methyl-1-(5-oxo-2H-furan-3-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl] 2-phenylbutanoate.
| Compound Name | [(1R,3E,7E)-4-(acetyloxymethyl)-8-methyl-1-(5-oxo-2H-furan-3-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 10438397 |
| Molecular Formula | C37H50O6 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | [(1R,3E,7E)-4-(acetyloxymethyl)-8-methyl-1-(5-oxo-2H-furan-3-yl)-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)O[C@H](C/C=C(\CC/C=C(\C)CCC1=C(C)CCCC1(C)C)COC(C)=O)C1=CC(=O)OC1)c1ccccc1 |
| InChI | InChI=1S/C37H50O6/c1-7-32(30-16-9-8-10-17-30)36(40)43-34(31-23-35(39)42-25-31)21-19-29(24-41-28(4)38)15-11-13-26(2)18-20-33-27(3)14-12-22-37(33,5)6/h8-10,13,16-17,19,23,32,34H,7,11-12,14-15,18,20-22,24-25H2,1-6H3/b26-13+,29-19+/t32?,34-/m1/s1 |
| InChIKey | PYZYLBJGSZYNKF-NAJWBIJJSA-N |
| XLogP | 8.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|