C36H44N4O5 — CID 10438748
[1-[7-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10438748) has the molecular formula C36H44N4O5 and a molecular weight of 612.77 g/mol. Its IUPAC name is [1-[7-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[7-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10438748 |
| Molecular Formula | C36H44N4O5 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | [1-[7-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)OC1CCN(CCCCCCCNC[C@H](O)c2ccc(O)c3[nH]c(=O)ccc23)CC1 |
| InChI | InChI=1S/C36H44N4O5/c41-32-17-15-29(30-16-18-34(43)39-35(30)32)33(42)25-37-21-9-2-1-3-10-22-40-23-19-27(20-24-40)45-36(44)38-31-14-8-7-13-28(31)26-11-5-4-6-12-26/h4-8,11-18,27,33,37,41-42H,1-3,9-10,19-25H2,(H,38,44)(H,39,43)/t33-/m0/s1 |
| InChIKey | KXDZFZWHYIWOHI-XIFFEERXSA-N |
| XLogP | 6.19 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|