C29H26ClF7N2O6 — CID 10439424
(4,4,4-trifluoro-2-methylbutan-2-yl) 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 10439424) has the molecular formula C29H26ClF7N2O6 and a molecular weight of 666.97 g/mol. Its IUPAC name is (4,4,4-trifluoro-2-methylbutan-2-yl) 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | (4,4,4-trifluoro-2-methylbutan-2-yl) 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 10439424 |
| Molecular Formula | C29H26ClF7N2O6 |
| Molecular Weight | 666.97 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | (4,4,4-trifluoro-2-methylbutan-2-yl) 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC[C@@H](C(=O)NC(CC(=O)OC(C)(C)CC(F)(F)F)C(=O)COc1c(F)c(F)cc(F)c1F)n1ccc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C29H26ClF7N2O6/c1-4-20(39-8-7-14-5-6-15(30)9-16(14)27(39)43)26(42)38-19(11-22(41)45-28(2,3)13-29(35,36)37)21(40)12-44-25-23(33)17(31)10-18(32)24(25)34/h5-10,19-20H,4,11-13H2,1-3H3,(H,38,42)/t19?,20-/m0/s1 |
| InChIKey | SPIVISFISLHZOX-ANYOKISRSA-N |
| XLogP | 5.96 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|