C40H33N3O7S — CID 10439712
(2Z)-2-[[2-hydroxy-4-[(4-methoxyphenyl)methoxycarbonyl]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 10439712) has the molecular formula C40H33N3O7S and a molecular weight of 699.78 g/mol. Its IUPAC name is (2Z)-2-[[2-hydroxy-4-[(4-methoxyphenyl)methoxycarbonyl]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-[[2-hydroxy-4-[(4-methoxyphenyl)methoxycarbonyl]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 10439712 |
| Molecular Formula | C40H33N3O7S |
| Molecular Weight | 699.78 g/mol |
| Exact Mass | 699.20 |
| IUPAC Name | (2Z)-2-[[2-hydroxy-4-[(4-methoxyphenyl)methoxycarbonyl]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(COC(=O)c2ccc(CO/N=C(\C(=O)O)c3csc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c(O)c2)cc1 |
| InChI | InChI=1S/C40H33N3O7S/c1-48-33-21-17-27(18-22-33)24-49-38(47)28-19-20-29(35(44)23-28)25-50-43-36(37(45)46)34-26-51-39(41-34)42-40(30-11-5-2-6-12-30,31-13-7-3-8-14-31)32-15-9-4-10-16-32/h2-23,26,44H,24-25H2,1H3,(H,41,42)(H,45,46)/b43-36- |
| InChIKey | SJZUTVLFUFJRPN-WOKNLOFWSA-N |
| XLogP | 7.62 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.78 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|