C25H25F6N5O7S3 — CID 10439835
4-[3-[4-[[amino-(methoxyamino)methylidene]amino]-2-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10439835) has the molecular formula C25H25F6N5O7S3 and a molecular weight of 717.69 g/mol. Its IUPAC name is 4-[3-[4-[[amino-(methoxyamino)methylidene]amino]-2-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[3-[4-[[amino-(methoxyamino)methylidene]amino]-2-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10439835 |
| Molecular Formula | C25H25F6N5O7S3 |
| Molecular Weight | 717.69 g/mol |
| Exact Mass | 717.08 |
| IUPAC Name | 4-[3-[4-[[amino-(methoxyamino)methylidene]amino]-2-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3ccc(/N=C(\N)NOC)cc3C)c2)c(SC)s1 |
| InChI | InChI=1S/C21H23N5O3S3.2C2HF3O2/c1-12-9-14(25-21(24)26-29-2)7-8-16(12)13-5-4-6-15(10-13)32(27,28)18-11-17(19(22)23)31-20(18)30-3;2*3-2(4,5)1(6)7/h4-11H,1-3H3,(H3,22,23)(H3,24,25,26);2*(H,6,7) |
| InChIKey | XAELJJWWOSVHSJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 218.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|