About 7H-purine
7H-purine (PubChem CID 1044) has the molecular formula C5H4N4
and a molecular weight of 120.11 g/mol. Its IUPAC name is 7H-purine.
Molecular Properties
| Compound Name | 7H-purine |
| PubChem CID | 1044 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 7H-purine |
| SMILES | c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
| InChIKey | KDCGOANMDULRCW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine?
The IUPAC name of 7H-purine (CID 1044) is 7H-purine.
What is the SMILES notation for 7H-purine?
The canonical SMILES for 7H-purine is c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine?
The InChIKey is KDCGOANMDULRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9).
What are the key properties of 7H-purine?
7H-purine has a molecular weight of 120.11 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine is sourced from PubChem (CID 1044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).