About Purine
Purine (PubChem CID 1044) has the molecular formula C5H4N4
and a molecular weight of 120.11 g/mol. Its IUPAC name is 7H-purine.
Molecular Properties
| Compound Name | Purine |
| PubChem CID | 1044 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 7H-purine |
| SMILES | C1=C2C(=NC=N1)N=CN2 |
| InChI | InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
| InChIKey | KDCGOANMDULRCW-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 54.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 105 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Purine?
The IUPAC name of Purine (CID 1044) is 7H-purine.
What is the SMILES notation for Purine?
The canonical SMILES for Purine is C1=C2C(=NC=N1)N=CN2.
What is the InChIKey of Purine?
The InChIKey is KDCGOANMDULRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9).
What are the key properties of Purine?
Purine has a molecular weight of 120.11 g/mol, XLogP of -0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Purine is sourced from PubChem (CID 1044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).