C32H37NO7 — CID 1044104
cyclopentyl (4S,7S)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1044104) has the molecular formula C32H37NO7 and a molecular weight of 547.65 g/mol. Its IUPAC name is cyclopentyl (4S,7S)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclopentyl (4S,7S)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1044104 |
| Molecular Formula | C32H37NO7 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | cyclopentyl (4S,7S)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccccc1[C@@H]1CC(=O)C2=C(C1)NC(C)=C(C(=O)OC1CCCC1)[C@H]2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H37NO7/c1-18-28(32(35)40-21-10-6-7-11-21)29(20-16-26(37-3)31(39-5)27(17-20)38-4)30-23(33-18)14-19(15-24(30)34)22-12-8-9-13-25(22)36-2/h8-9,12-13,16-17,19,21,29,33H,6-7,10-11,14-15H2,1-5H3/t19-,29+/m0/s1 |
| InChIKey | QWNHNWFLLWBJJZ-ADXZGYQBSA-N |
| XLogP | 5.57 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |