About 2,5-diethyltetrazole
2,5-diethyltetrazole (PubChem CID 10441712) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2,5-diethyltetrazole.
Molecular Properties
| Compound Name | 2,5-diethyltetrazole |
| PubChem CID | 10441712 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 2,5-diethyltetrazole |
| SMILES | CCc1nnn(CC)n1 |
| InChI | InChI=1S/C5H10N4/c1-3-5-6-8-9(4-2)7-5/h3-4H2,1-2H3 |
| InChIKey | MRTHIBSYBORMSI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-diethyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diethyltetrazole?
The IUPAC name of 2,5-diethyltetrazole (CID 10441712) is 2,5-diethyltetrazole.
What is the SMILES notation for 2,5-diethyltetrazole?
The canonical SMILES for 2,5-diethyltetrazole is CCc1nnn(CC)n1.
What is the InChIKey of 2,5-diethyltetrazole?
The InChIKey is MRTHIBSYBORMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4/c1-3-5-6-8-9(4-2)7-5/h3-4H2,1-2H3.
What are the key properties of 2,5-diethyltetrazole?
2,5-diethyltetrazole has a molecular weight of 126.16 g/mol, XLogP of 0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diethyltetrazole is sourced from PubChem (CID 10441712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).