About imidazolidin-2-ylurea
imidazolidin-2-ylurea (PubChem CID 10441726) has the molecular formula C4H10N4O
and a molecular weight of 130.15 g/mol. Its IUPAC name is imidazolidin-2-ylurea.
Molecular Properties
| Compound Name | imidazolidin-2-ylurea |
| PubChem CID | 10441726 |
| Molecular Formula | C4H10N4O |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | imidazolidin-2-ylurea |
| SMILES | NC(=O)NC1NCCN1 |
| InChI | InChI=1S/C4H10N4O/c5-3(9)8-4-6-1-2-7-4/h4,6-7H,1-2H2,(H3,5,8,9) |
| InChIKey | HJOKGKCVJCJKNJ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazolidin-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidin-2-ylurea?
The IUPAC name of imidazolidin-2-ylurea (CID 10441726) is imidazolidin-2-ylurea.
What is the SMILES notation for imidazolidin-2-ylurea?
The canonical SMILES for imidazolidin-2-ylurea is NC(=O)NC1NCCN1.
What is the InChIKey of imidazolidin-2-ylurea?
The InChIKey is HJOKGKCVJCJKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4O/c5-3(9)8-4-6-1-2-7-4/h4,6-7H,1-2H2,(H3,5,8,9).
What are the key properties of imidazolidin-2-ylurea?
imidazolidin-2-ylurea has a molecular weight of 130.15 g/mol, XLogP of -1.87, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidin-2-ylurea is sourced from PubChem (CID 10441726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).