About [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine
[(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine (PubChem CID 10441741) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine.
Molecular Properties
| Compound Name | [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine |
| PubChem CID | 10441741 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine |
| SMILES | NC[C@H]1OCO[C@@H]1CN |
| InChI | InChI=1S/C5H12N2O2/c6-1-4-5(2-7)9-3-8-4/h4-5H,1-3,6-7H2/t4-,5-/m1/s1 |
| InChIKey | IVKNYMXGZKPFOJ-RFZPGFLSSA-N |
| XLogP | -1.35 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine?
The IUPAC name of [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine (CID 10441741) is [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine.
What is the SMILES notation for [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine?
The canonical SMILES for [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine is NC[C@H]1OCO[C@@H]1CN.
What is the InChIKey of [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine?
The InChIKey is IVKNYMXGZKPFOJ-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H12N2O2/c6-1-4-5(2-7)9-3-8-4/h4-5H,1-3,6-7H2/t4-,5-/m1/s1.
What are the key properties of [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine?
[(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine has a molecular weight of 132.16 g/mol, XLogP of -1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5R)-5-(aminomethyl)-1,3-dioxolan-4-yl]methanamine is sourced from PubChem (CID 10441741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).