C9H7N3O — CID 10442175
(1aR,6S,6aS)-6-azido-6,6a-dihydro-1aH-indeno[1,2-b]oxirene (PubChem CID 10442175) has the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. Its IUPAC name is (1aR,6S,6aS)-6-azido-6,6a-dihydro-1aH-indeno[1,2-b]oxirene.
| Compound Name | (1aR,6S,6aS)-6-azido-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 10442175 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (1aR,6S,6aS)-6-azido-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
| SMILES | [N-]=[N+]=N[C@H]1c2ccccc2[C@H]2O[C@H]21 |
| InChI | InChI=1S/C9H7N3O/c10-12-11-7-5-3-1-2-4-6(5)8-9(7)13-8/h1-4,7-9H/t7-,8+,9-/m0/s1 |
| InChIKey | MNIWDEWZVVPWFM-YIZRAAEISA-N |
| XLogP | 2.49 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|