About 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole
2-(phenoxymethyl)-4,5-dihydro-1H-imidazole (PubChem CID 10442227) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 10442227 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc(OCC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N2O/c1-2-4-9(5-3-1)13-8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12) |
| InChIKey | GRMJZZBFHKTYDJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole (CID 10442227) is 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole is c1ccc(OCC2=NCCN2)cc1.
What is the InChIKey of 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is GRMJZZBFHKTYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-2-4-9(5-3-1)13-8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12).
What are the key properties of 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole?
2-(phenoxymethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 176.22 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenoxymethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10442227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).