About 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one
4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 10442251) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 10442251 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCC(O)c2cccc(O)c21 |
| InChI | InChI=1S/C10H10O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-3,7,11-12H,4-5H2 |
| InChIKey | ZXYYTDCENDYKBR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one (CID 10442251) is 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one is O=C1CCC(O)c2cccc(O)c21.
What is the InChIKey of 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is ZXYYTDCENDYKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-3,7,11-12H,4-5H2.
What are the key properties of 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one?
4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 178.19 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 10442251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).