C11H16O2 — CID 10442297
(1S,2R,4S,5R)-1-ethyl-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 10442297) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1S,2R,4S,5R)-1-ethyl-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2R,4S,5R)-1-ethyl-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 10442297 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1S,2R,4S,5R)-1-ethyl-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC[C@@]12C=C[C@@H](O1)[C@H](C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C11H16O2/c1-4-11-6-5-9(13-11)7(2)10(12)8(11)3/h5-9H,4H2,1-3H3/t7-,8-,9+,11-/m0/s1 |
| InChIKey | KJAAZNQVOLLOFI-CKEKPRIKSA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|