About 4-cyclohexylidenethiane
4-cyclohexylidenethiane (PubChem CID 10442355) has the molecular formula C11H18S
and a molecular weight of 182.33 g/mol. Its IUPAC name is 4-cyclohexylidenethiane.
Molecular Properties
| Compound Name | 4-cyclohexylidenethiane |
| PubChem CID | 10442355 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4-cyclohexylidenethiane |
| SMILES | C1CCC(=C2CCSCC2)CC1 |
| InChI | InChI=1S/C11H18S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-9H2 |
| InChIKey | HQSLYBBNNFNYFM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylidenethiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylidenethiane?
The IUPAC name of 4-cyclohexylidenethiane (CID 10442355) is 4-cyclohexylidenethiane.
What is the SMILES notation for 4-cyclohexylidenethiane?
The canonical SMILES for 4-cyclohexylidenethiane is C1CCC(=C2CCSCC2)CC1.
What is the InChIKey of 4-cyclohexylidenethiane?
The InChIKey is HQSLYBBNNFNYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-9H2.
What are the key properties of 4-cyclohexylidenethiane?
4-cyclohexylidenethiane has a molecular weight of 182.33 g/mol, XLogP of 3.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylidenethiane is sourced from PubChem (CID 10442355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).