About (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol
(3E)-3-ethylidene-5,5-dipropyloxolan-2-ol (PubChem CID 10442733) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol.
Molecular Properties
| Compound Name | (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol |
| PubChem CID | 10442733 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol |
| SMILES | C/C=C1\CC(CCC)(CCC)OC1O |
| InChI | InChI=1S/C12H22O2/c1-4-7-12(8-5-2)9-10(6-3)11(13)14-12/h6,11,13H,4-5,7-9H2,1-3H3/b10-6+ |
| InChIKey | JYGRINGAUNIHEZ-UXBLZVDNSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol?
The IUPAC name of (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol (CID 10442733) is (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol.
What is the SMILES notation for (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol?
The canonical SMILES for (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol is C/C=C1\CC(CCC)(CCC)OC1O.
What is the InChIKey of (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol?
The InChIKey is JYGRINGAUNIHEZ-UXBLZVDNSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-7-12(8-5-2)9-10(6-3)11(13)14-12/h6,11,13H,4-5,7-9H2,1-3H3/b10-6+.
What are the key properties of (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol?
(3E)-3-ethylidene-5,5-dipropyloxolan-2-ol has a molecular weight of 198.31 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-ethylidene-5,5-dipropyloxolan-2-ol is sourced from PubChem (CID 10442733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).