C13H13NO — CID 10442752
4,4a,5,6-tetrahydrobenzo[f]quinolizin-3-one (PubChem CID 10442752) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 4,4a,5,6-tetrahydrobenzo[f]quinolizin-3-one.
| Compound Name | 4,4a,5,6-tetrahydrobenzo[f]quinolizin-3-one |
|---|---|
| PubChem CID | 10442752 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4,4a,5,6-tetrahydrobenzo[f]quinolizin-3-one |
| SMILES | O=C1C=CN2c3ccccc3CCC2C1 |
| InChI | InChI=1S/C13H13NO/c15-12-7-8-14-11(9-12)6-5-10-3-1-2-4-13(10)14/h1-4,7-8,11H,5-6,9H2 |
| InChIKey | LNTWPSKEEYNUKK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |