About 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one
5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one (PubChem CID 10442877) has the molecular formula C11H9NOS
and a molecular weight of 203.27 g/mol. Its IUPAC name is 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one.
Molecular Properties
| Compound Name | 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one |
| PubChem CID | 10442877 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2c1-c1ccsc1CC2 |
| InChI | InChI=1S/C11H9NOS/c13-11-10-7(3-5-12-11)1-2-9-8(10)4-6-14-9/h3-6H,1-2H2,(H,12,13) |
| InChIKey | ANFXRYISGYZCHH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one?
The IUPAC name of 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one (CID 10442877) is 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one.
What is the SMILES notation for 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one?
The canonical SMILES for 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one is O=c1[nH]ccc2c1-c1ccsc1CC2.
What is the InChIKey of 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one?
The InChIKey is ANFXRYISGYZCHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NOS/c13-11-10-7(3-5-12-11)1-2-9-8(10)4-6-14-9/h3-6H,1-2H2,(H,12,13).
What are the key properties of 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one?
5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one has a molecular weight of 203.27 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-2H-thieno[2,3-h]isoquinolin-1-one is sourced from PubChem (CID 10442877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).