C6H10N2O2S2 — CID 10442981
5,6-dimethyl-1,2,5,6-dithiadiazocane-4,7-dione (PubChem CID 10442981) has the molecular formula C6H10N2O2S2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 5,6-dimethyl-1,2,5,6-dithiadiazocane-4,7-dione.
| Compound Name | 5,6-dimethyl-1,2,5,6-dithiadiazocane-4,7-dione |
|---|---|
| PubChem CID | 10442981 |
| Molecular Formula | C6H10N2O2S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 5,6-dimethyl-1,2,5,6-dithiadiazocane-4,7-dione |
| SMILES | CN1C(=O)CSSCC(=O)N1C |
| InChI | InChI=1S/C6H10N2O2S2/c1-7-5(9)3-11-12-4-6(10)8(7)2/h3-4H2,1-2H3 |
| InChIKey | DJCAFQJLTXKFSP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|