C14H27N — CID 10443078
(2R,3E,5E)-tetradeca-3,5-dien-2-amine (PubChem CID 10443078) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (2R,3E,5E)-tetradeca-3,5-dien-2-amine.
| Compound Name | (2R,3E,5E)-tetradeca-3,5-dien-2-amine |
|---|---|
| PubChem CID | 10443078 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (2R,3E,5E)-tetradeca-3,5-dien-2-amine |
| SMILES | CCCCCCCC/C=C/C=C/[C@@H](C)N |
| InChI | InChI=1S/C14H27N/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h10-14H,3-9,15H2,1-2H3/b11-10+,13-12+/t14-/m1/s1 |
| InChIKey | WCUPLXASCCDKJN-PBKZMAJUSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|