About 9-amino-9H-xanthen-3-ol
9-amino-9H-xanthen-3-ol (PubChem CID 10443193) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is 9-amino-9H-xanthen-3-ol.
Molecular Properties
| Compound Name | 9-amino-9H-xanthen-3-ol |
| PubChem CID | 10443193 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 9-amino-9H-xanthen-3-ol |
| SMILES | NC1c2ccccc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C13H11NO2/c14-13-9-3-1-2-4-11(9)16-12-7-8(15)5-6-10(12)13/h1-7,13,15H,14H2 |
| InChIKey | KDSSPEDHBINNBQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-amino-9H-xanthen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-9H-xanthen-3-ol?
The IUPAC name of 9-amino-9H-xanthen-3-ol (CID 10443193) is 9-amino-9H-xanthen-3-ol.
What is the SMILES notation for 9-amino-9H-xanthen-3-ol?
The canonical SMILES for 9-amino-9H-xanthen-3-ol is NC1c2ccccc2Oc2cc(O)ccc21.
What is the InChIKey of 9-amino-9H-xanthen-3-ol?
The InChIKey is KDSSPEDHBINNBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c14-13-9-3-1-2-4-11(9)16-12-7-8(15)5-6-10(12)13/h1-7,13,15H,14H2.
What are the key properties of 9-amino-9H-xanthen-3-ol?
9-amino-9H-xanthen-3-ol has a molecular weight of 213.24 g/mol, XLogP of 2.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-9H-xanthen-3-ol is sourced from PubChem (CID 10443193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).