C14H16O2 — CID 10443303
(3aS,4S,8bS)-4-propyl-1,3a,4,8b-tetrahydroindeno[1,2-c]furan-3-one (PubChem CID 10443303) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (3aS,4S,8bS)-4-propyl-1,3a,4,8b-tetrahydroindeno[1,2-c]furan-3-one.
| Compound Name | (3aS,4S,8bS)-4-propyl-1,3a,4,8b-tetrahydroindeno[1,2-c]furan-3-one |
|---|---|
| PubChem CID | 10443303 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3aS,4S,8bS)-4-propyl-1,3a,4,8b-tetrahydroindeno[1,2-c]furan-3-one |
| SMILES | CCC[C@@H]1c2ccccc2[C@H]2COC(=O)[C@@H]12 |
| InChI | InChI=1S/C14H16O2/c1-2-5-11-9-6-3-4-7-10(9)12-8-16-14(15)13(11)12/h3-4,6-7,11-13H,2,5,8H2,1H3/t11-,12-,13+/m1/s1 |
| InChIKey | YCBYVAPPIRGJPJ-UPJWGTAASA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |