About 8-butoxyquinolin-2-amine
8-butoxyquinolin-2-amine (PubChem CID 10443307) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 8-butoxyquinolin-2-amine.
Molecular Properties
| Compound Name | 8-butoxyquinolin-2-amine |
| PubChem CID | 10443307 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 8-butoxyquinolin-2-amine |
| SMILES | CCCCOc1cccc2ccc(N)nc12 |
| InChI | InChI=1S/C13H16N2O/c1-2-3-9-16-11-6-4-5-10-7-8-12(14)15-13(10)11/h4-8H,2-3,9H2,1H3,(H2,14,15) |
| InChIKey | RANHBKGFWNIVKN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-butoxyquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butoxyquinolin-2-amine?
The IUPAC name of 8-butoxyquinolin-2-amine (CID 10443307) is 8-butoxyquinolin-2-amine.
What is the SMILES notation for 8-butoxyquinolin-2-amine?
The canonical SMILES for 8-butoxyquinolin-2-amine is CCCCOc1cccc2ccc(N)nc12.
What is the InChIKey of 8-butoxyquinolin-2-amine?
The InChIKey is RANHBKGFWNIVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-2-3-9-16-11-6-4-5-10-7-8-12(14)15-13(10)11/h4-8H,2-3,9H2,1H3,(H2,14,15).
What are the key properties of 8-butoxyquinolin-2-amine?
8-butoxyquinolin-2-amine has a molecular weight of 216.28 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butoxyquinolin-2-amine is sourced from PubChem (CID 10443307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).