C11H11N3O2 — CID 10443331
1,4,7,8,9,10-hexahydropyrido[4,3-f]quinoxaline-2,3-dione (PubChem CID 10443331) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 1,4,7,8,9,10-hexahydropyrido[4,3-f]quinoxaline-2,3-dione.
| Compound Name | 1,4,7,8,9,10-hexahydropyrido[4,3-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10443331 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1,4,7,8,9,10-hexahydropyrido[4,3-f]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc3c(c2[nH]c1=O)CCNC3 |
| InChI | InChI=1S/C11H11N3O2/c15-10-11(16)14-9-7-3-4-12-5-6(7)1-2-8(9)13-10/h1-2,12H,3-5H2,(H,13,15)(H,14,16) |
| InChIKey | SIAMYJHXBZULSQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|