C9H14O6 — CID 10443358
[(3S,4S,5S,6S)-3,4,5,6-tetrahydroxycyclohexen-1-yl]methyl acetate (PubChem CID 10443358) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is [(3S,4S,5S,6S)-3,4,5,6-tetrahydroxycyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S,5S,6S)-3,4,5,6-tetrahydroxycyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10443358 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [(3S,4S,5S,6S)-3,4,5,6-tetrahydroxycyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14O6/c1-4(10)15-3-5-2-6(11)8(13)9(14)7(5)12/h2,6-9,11-14H,3H2,1H3/t6-,7-,8-,9-/m0/s1 |
| InChIKey | QBVXDOMUJIZMRX-JBDRJPRFSA-N |
| XLogP | -2.07 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|