C11H18N4O — CID 10443542
3-pentyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole (PubChem CID 10443542) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-pentyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-pentyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 10443542 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3-pentyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
| SMILES | CCCCCc1noc(C2CN=CNC2)n1 |
| InChI | InChI=1S/C11H18N4O/c1-2-3-4-5-10-14-11(16-15-10)9-6-12-8-13-7-9/h8-9H,2-7H2,1H3,(H,12,13) |
| InChIKey | PEMYAVVNLNBNFE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|