About 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid
3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid (PubChem CID 10443595) has the molecular formula C11H12O5
and a molecular weight of 224.21 g/mol. Its IUPAC name is 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid |
| PubChem CID | 10443595 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid |
| SMILES | CC/C=C/C1=C(CCC(=O)O)C(=O)OC1=O |
| InChI | InChI=1S/C11H12O5/c1-2-3-4-7-8(5-6-9(12)13)11(15)16-10(7)14/h3-4H,2,5-6H2,1H3,(H,12,13)/b4-3+ |
| InChIKey | KMMGWWCKVLBXLF-ONEGZZNKSA-N |
| XLogP | 1.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid?
The IUPAC name of 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid (CID 10443595) is 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid.
What is the SMILES notation for 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid?
The canonical SMILES for 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid is CC/C=C/C1=C(CCC(=O)O)C(=O)OC1=O.
What is the InChIKey of 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid?
The InChIKey is KMMGWWCKVLBXLF-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H12O5/c1-2-3-4-7-8(5-6-9(12)13)11(15)16-10(7)14/h3-4H,2,5-6H2,1H3,(H,12,13)/b4-3+.
What are the key properties of 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid?
3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid has a molecular weight of 224.21 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(E)-but-1-enyl]-2,5-dioxofuran-3-yl]propanoic acid is sourced from PubChem (CID 10443595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).