C13H24OSi — CID 10443627
[(1R,4R,5S)-4-but-3-enyl-1-bicyclo[3.1.0]hexanyl]oxy-trimethylsilane (PubChem CID 10443627) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is [(1R,4R,5S)-4-but-3-enyl-1-bicyclo[3.1.0]hexanyl]oxy-trimethylsilane.
| Compound Name | [(1R,4R,5S)-4-but-3-enyl-1-bicyclo[3.1.0]hexanyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10443627 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [(1R,4R,5S)-4-but-3-enyl-1-bicyclo[3.1.0]hexanyl]oxy-trimethylsilane |
| SMILES | C=CCC[C@@H]1CC[C@@]2(O[Si](C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C13H24OSi/c1-5-6-7-11-8-9-13(10-12(11)13)14-15(2,3)4/h5,11-12H,1,6-10H2,2-4H3/t11-,12+,13-/m1/s1 |
| InChIKey | LTPLSPZDRJGGGP-FRRDWIJNSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|