C14H26O2 — CID 10443713
(3R,4R,7S,8S)-4,7-bis(ethenyl)decane-3,8-diol (PubChem CID 10443713) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (3R,4R,7S,8S)-4,7-bis(ethenyl)decane-3,8-diol.
| Compound Name | (3R,4R,7S,8S)-4,7-bis(ethenyl)decane-3,8-diol |
|---|---|
| PubChem CID | 10443713 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (3R,4R,7S,8S)-4,7-bis(ethenyl)decane-3,8-diol |
| SMILES | C=C[C@H](CC[C@H](C=C)[C@H](O)CC)[C@@H](O)CC |
| InChI | InChI=1S/C14H26O2/c1-5-11(13(15)7-3)9-10-12(6-2)14(16)8-4/h5-6,11-16H,1-2,7-10H2,3-4H3/t11-,12+,13+,14- |
| InChIKey | XNMDDEHUQZUUER-LVEBTZEWSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|