C11H17NO4 — CID 10443728
dimethyl 2-(2,2-dimethyl-3-methyliminopropylidene)propanedioate (PubChem CID 10443728) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is dimethyl 2-(2,2-dimethyl-3-methyliminopropylidene)propanedioate.
| Compound Name | dimethyl 2-(2,2-dimethyl-3-methyliminopropylidene)propanedioate |
|---|---|
| PubChem CID | 10443728 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | dimethyl 2-(2,2-dimethyl-3-methyliminopropylidene)propanedioate |
| SMILES | C/N=C/C(C)(C)C=C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H17NO4/c1-11(2,7-12-3)6-8(9(13)15-4)10(14)16-5/h6-7H,1-5H3/b12-7+ |
| InChIKey | LOTLKCMMNQXBFR-KPKJPENVSA-N |
| XLogP | 0.99 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|