C13H14O4 — CID 10444015
(3R,4R)-4-hydroxyspiro[4H-isochromene-3,2'-oxane]-1-one (PubChem CID 10444015) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (3R,4R)-4-hydroxyspiro[4H-isochromene-3,2'-oxane]-1-one.
| Compound Name | (3R,4R)-4-hydroxyspiro[4H-isochromene-3,2'-oxane]-1-one |
|---|---|
| PubChem CID | 10444015 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (3R,4R)-4-hydroxyspiro[4H-isochromene-3,2'-oxane]-1-one |
| SMILES | O=C1O[C@]2(CCCCO2)[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C13H14O4/c14-11-9-5-1-2-6-10(9)12(15)17-13(11)7-3-4-8-16-13/h1-2,5-6,11,14H,3-4,7-8H2/t11-,13-/m1/s1 |
| InChIKey | REYIFPRIFRWNLQ-DGCLKSJQSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |