C12H20N4O — CID 10444134
3-hexyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole (PubChem CID 10444134) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-hexyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-hexyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 10444134 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-hexyl-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
| SMILES | CCCCCCc1noc(C2CN=CNC2)n1 |
| InChI | InChI=1S/C12H20N4O/c1-2-3-4-5-6-11-15-12(17-16-11)10-7-13-9-14-8-10/h9-10H,2-8H2,1H3,(H,13,14) |
| InChIKey | JYXQZNHNZREZJL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|