About spiro[pyrrolidine-3,9'-xanthene]
spiro[pyrrolidine-3,9'-xanthene] (PubChem CID 10444168) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is spiro[pyrrolidine-3,9'-xanthene].
Molecular Properties
| Compound Name | spiro[pyrrolidine-3,9'-xanthene] |
| PubChem CID | 10444168 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | spiro[pyrrolidine-3,9'-xanthene] |
| SMILES | c1ccc2c(c1)Oc1ccccc1C21CCNC1 |
| InChI | InChI=1S/C16H15NO/c1-3-7-14-12(5-1)16(9-10-17-11-16)13-6-2-4-8-15(13)18-14/h1-8,17H,9-11H2 |
| InChIKey | YMGYTLOMZJSEAZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[pyrrolidine-3,9'-xanthene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[pyrrolidine-3,9'-xanthene]?
The IUPAC name of spiro[pyrrolidine-3,9'-xanthene] (CID 10444168) is spiro[pyrrolidine-3,9'-xanthene].
What is the SMILES notation for spiro[pyrrolidine-3,9'-xanthene]?
The canonical SMILES for spiro[pyrrolidine-3,9'-xanthene] is c1ccc2c(c1)Oc1ccccc1C21CCNC1.
What is the InChIKey of spiro[pyrrolidine-3,9'-xanthene]?
The InChIKey is YMGYTLOMZJSEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO/c1-3-7-14-12(5-1)16(9-10-17-11-16)13-6-2-4-8-15(13)18-14/h1-8,17H,9-11H2.
What are the key properties of spiro[pyrrolidine-3,9'-xanthene]?
spiro[pyrrolidine-3,9'-xanthene] has a molecular weight of 237.30 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[pyrrolidine-3,9'-xanthene] is sourced from PubChem (CID 10444168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).