About chlorozinc(1+);1,2-dimethoxybenzene-5-ide
chlorozinc(1+);1,2-dimethoxybenzene-5-ide (PubChem CID 10444187) has the molecular formula C8H9ClO2Zn
and a molecular weight of 238.00 g/mol. Its IUPAC name is chlorozinc(1+);1,2-dimethoxybenzene-5-ide.
Molecular Properties
| Compound Name | chlorozinc(1+);1,2-dimethoxybenzene-5-ide |
| PubChem CID | 10444187 |
| Molecular Formula | C8H9ClO2Zn |
| Molecular Weight | 238.00 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | chlorozinc(1+);1,2-dimethoxybenzene-5-ide |
| SMILES | COc1c[c-]ccc1OC.Cl[Zn+] |
| InChI | InChI=1S/C8H9O2.ClH.Zn/c1-9-7-5-3-4-6-8(7)10-2;;/h3,5-6H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | IPNBXFSAOVMSJV-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.00 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);1,2-dimethoxybenzene-5-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);1,2-dimethoxybenzene-5-ide?
The IUPAC name of chlorozinc(1+);1,2-dimethoxybenzene-5-ide (CID 10444187) is chlorozinc(1+);1,2-dimethoxybenzene-5-ide.
What is the SMILES notation for chlorozinc(1+);1,2-dimethoxybenzene-5-ide?
The canonical SMILES for chlorozinc(1+);1,2-dimethoxybenzene-5-ide is COc1c[c-]ccc1OC.Cl[Zn+].
What is the InChIKey of chlorozinc(1+);1,2-dimethoxybenzene-5-ide?
The InChIKey is IPNBXFSAOVMSJV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9O2.ClH.Zn/c1-9-7-5-3-4-6-8(7)10-2;;/h3,5-6H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of chlorozinc(1+);1,2-dimethoxybenzene-5-ide?
chlorozinc(1+);1,2-dimethoxybenzene-5-ide has a molecular weight of 238.00 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);1,2-dimethoxybenzene-5-ide is sourced from PubChem (CID 10444187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).