C6H11F4O3P — CID 10444192
1-diethoxyphosphoryl-1,1,2,2-tetrafluoroethane (PubChem CID 10444192) has the molecular formula C6H11F4O3P and a molecular weight of 238.12 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1,2,2-tetrafluoroethane.
| Compound Name | 1-diethoxyphosphoryl-1,1,2,2-tetrafluoroethane |
|---|---|
| PubChem CID | 10444192 |
| Molecular Formula | C6H11F4O3P |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1,2,2-tetrafluoroethane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H11F4O3P/c1-3-12-14(11,13-4-2)6(9,10)5(7)8/h5H,3-4H2,1-2H3 |
| InChIKey | OLPYHGXMPASFTI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|