C13H20O4 — CID 10444311
(3R,3aS,6R,6aR)-6-hexyl-3-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione (PubChem CID 10444311) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3R,3aS,6R,6aR)-6-hexyl-3-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione.
| Compound Name | (3R,3aS,6R,6aR)-6-hexyl-3-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione |
|---|---|
| PubChem CID | 10444311 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3R,3aS,6R,6aR)-6-hexyl-3-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione |
| SMILES | CCCCCC[C@H]1OC(=O)[C@@H]2[C@H]1OC(=O)[C@@H]2C |
| InChI | InChI=1S/C13H20O4/c1-3-4-5-6-7-9-11-10(13(15)16-9)8(2)12(14)17-11/h8-11H,3-7H2,1-2H3/t8-,9-,10+,11+/m1/s1 |
| InChIKey | GYNBJTQSZUKTMJ-ZNSHCXBVSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|