About 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate
2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate (PubChem CID 10444400) has the molecular formula C9H10N2O4S
and a molecular weight of 242.26 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate |
| PubChem CID | 10444400 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate |
| SMILES | C[n+]1cc(C2=C([O-])OC(C)(C)OC2=O)sn1 |
| InChI | InChI=1S/C9H10N2O4S/c1-9(2)14-7(12)6(8(13)15-9)5-4-11(3)10-16-5/h4H,1-3H3 |
| InChIKey | GUADUTNBCQTOQF-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate?
The IUPAC name of 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate (CID 10444400) is 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate.
What is the SMILES notation for 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate?
The canonical SMILES for 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate is C[n+]1cc(C2=C([O-])OC(C)(C)OC2=O)sn1.
What is the InChIKey of 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate?
The InChIKey is GUADUTNBCQTOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4S/c1-9(2)14-7(12)6(8(13)15-9)5-4-11(3)10-16-5/h4H,1-3H3.
What are the key properties of 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate?
2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate has a molecular weight of 242.26 g/mol, XLogP of -0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-(3-methylthiadiazol-3-ium-5-yl)-6-oxo-1,3-dioxin-4-olate is sourced from PubChem (CID 10444400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).