About (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate
(5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate (PubChem CID 10444425) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate |
| PubChem CID | 10444425 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate |
| SMILES | CCOCC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C14H26O3/c1-5-16-9-14(15)17-13-8-11(4)6-7-12(13)10(2)3/h10-13H,5-9H2,1-4H3 |
| InChIKey | DXGZIMYAPNIRHS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate (CID 10444425) is (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate is CCOCC(=O)OC1CC(C)CCC1C(C)C.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate?
The InChIKey is DXGZIMYAPNIRHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-5-16-9-14(15)17-13-8-11(4)6-7-12(13)10(2)3/h10-13H,5-9H2,1-4H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate?
(5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate has a molecular weight of 242.36 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 2-ethoxyacetate is sourced from PubChem (CID 10444425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).