C13H12N2O3 — CID 10444494
methyl (1R,12S)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate (PubChem CID 10444494) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is methyl (1R,12S)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate.
| Compound Name | methyl (1R,12S)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
|---|---|
| PubChem CID | 10444494 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | methyl (1R,12S)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)C(=O)C=C1NC[C@H]3C[C@]123 |
| InChI | InChI=1S/C13H12N2O3/c1-18-12(17)8-2-7-11(15-8)9(16)3-10-13(7)4-6(13)5-14-10/h2-3,6,14-15H,4-5H2,1H3/t6-,13-/m1/s1 |
| InChIKey | WGNPBBFIIOZGQI-CAAJLBCPSA-N |
| XLogP | 0.74 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |